C17H22N4OS — CID 137265163
(5Z)-2-(2,4-dimethylphenyl)imino-5-[(3,5-dimethylpyrazolidin-4-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137265163) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is (5Z)-2-(2,4-dimethylphenyl)imino-5-[(3,5-dimethylpyrazolidin-4-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2,4-dimethylphenyl)imino-5-[(3,5-dimethylpyrazolidin-4-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137265163 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (5Z)-2-(2,4-dimethylphenyl)imino-5-[(3,5-dimethylpyrazolidin-4-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2/NC(=O)/C(=C/C3C(C)NNC3C)S2)c(C)c1 |
| InChI | InChI=1S/C17H22N4OS/c1-9-5-6-14(10(2)7-9)18-17-19-16(22)15(23-17)8-13-11(3)20-21-12(13)4/h5-8,11-13,20-21H,1-4H3,(H,18,19,22)/b15-8- |
| InChIKey | WBDVUJVDQYHKDI-NVNXTCNLSA-N |
| XLogP | 2.54 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|