C16H22N4O3S — CID 137268392
2-[[1-(2-methylsulfonylethyl)piperidin-4-yl]amino]-3H-quinazolin-4-one (PubChem CID 137268392) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-[[1-(2-methylsulfonylethyl)piperidin-4-yl]amino]-3H-quinazolin-4-one.
| Compound Name | 2-[[1-(2-methylsulfonylethyl)piperidin-4-yl]amino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137268392 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[[1-(2-methylsulfonylethyl)piperidin-4-yl]amino]-3H-quinazolin-4-one |
| SMILES | CS(=O)(=O)CCN1CCC(Nc2nc3ccccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C16H22N4O3S/c1-24(22,23)11-10-20-8-6-12(7-9-20)17-16-18-14-5-3-2-4-13(14)15(21)19-16/h2-5,12H,6-11H2,1H3,(H2,17,18,19,21) |
| InChIKey | PEBAWHJYKFQQEK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |