C16H20N4O2 — CID 137269546
2-(3-oxo-4-propyl-1,4-diazepan-1-yl)-3H-quinazolin-4-one (PubChem CID 137269546) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-(3-oxo-4-propyl-1,4-diazepan-1-yl)-3H-quinazolin-4-one.
| Compound Name | 2-(3-oxo-4-propyl-1,4-diazepan-1-yl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137269546 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-(3-oxo-4-propyl-1,4-diazepan-1-yl)-3H-quinazolin-4-one |
| SMILES | CCCN1CCCN(c2nc3ccccc3c(=O)[nH]2)CC1=O |
| InChI | InChI=1S/C16H20N4O2/c1-2-8-19-9-5-10-20(11-14(19)21)16-17-13-7-4-3-6-12(13)15(22)18-16/h3-4,6-7H,2,5,8-11H2,1H3,(H,17,18,22) |
| InChIKey | DEKQCAZSLXCVOJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |