C6H11N3O2 — CID 137270848
(3Z,4E)-4-(dimethylhydrazinylidene)-3-hydroxyiminobutan-2-one (PubChem CID 137270848) has the molecular formula C6H11N3O2 and a molecular weight of 157.17 g/mol. Its IUPAC name is (3Z,4E)-4-(dimethylhydrazinylidene)-3-hydroxyiminobutan-2-one.
| Compound Name | (3Z,4E)-4-(dimethylhydrazinylidene)-3-hydroxyiminobutan-2-one |
|---|---|
| PubChem CID | 137270848 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (3Z,4E)-4-(dimethylhydrazinylidene)-3-hydroxyiminobutan-2-one |
| SMILES | CC(=O)C(/C=N/N(C)C)=N\O |
| InChI | InChI=1S/C6H11N3O2/c1-5(10)6(8-11)4-7-9(2)3/h4,11H,1-3H3/b7-4+,8-6- |
| InChIKey | AAFUGJSTJCEPCU-MTCKZIEXSA-N |
| XLogP | -0.05 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|