About CID 162046175
CID 162046175 (PubChem CID 162046175) has the molecular formula C9H17N2O4Pb
and a molecular weight of 424.45 g/mol.
Molecular Properties
| Compound Name | CID 162046175 |
| PubChem CID | 162046175 |
| Molecular Formula | C9H17N2O4Pb |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | — |
| SMILES | CC(=O)/C(C)=N/O.CC(=O)C(C)=NO.C[Pb] |
| InChI | InChI=1S/2C4H7NO2.CH3.Pb/c2*1-3(5-7)4(2)6;;/h2*7H,1-2H3;1H3;/b5-3+;;; |
| InChIKey | YXXKZMVBGJCDDM-PTPDRMABSA-N |
| XLogP | 1.05 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 162046175 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162046175?
The IUPAC name of CID 162046175 (CID 162046175) is not available.
What is the SMILES notation for CID 162046175?
The canonical SMILES for CID 162046175 is CC(=O)/C(C)=N/O.CC(=O)C(C)=NO.C[Pb].
What is the InChIKey of CID 162046175?
The InChIKey is YXXKZMVBGJCDDM-PTPDRMABSA-N. The full InChI is InChI=1S/2C4H7NO2.CH3.Pb/c2*1-3(5-7)4(2)6;;/h2*7H,1-2H3;1H3;/b5-3+;;;.
What are the key properties of CID 162046175?
CID 162046175 has a molecular weight of 424.45 g/mol, XLogP of 1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162046175 is sourced from PubChem (CID 162046175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).