C4H7NO2 — CID 177440866
(3E)-1,1,1-trideuterio-3-hydroxyiminobutan-2-one (PubChem CID 177440866) has the molecular formula C4H7NO2 and a molecular weight of 104.12 g/mol. Its IUPAC name is (3E)-1,1,1-trideuterio-3-hydroxyiminobutan-2-one.
| Compound Name | (3E)-1,1,1-trideuterio-3-hydroxyiminobutan-2-one |
|---|---|
| PubChem CID | 177440866 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 104.12 g/mol |
| Exact Mass | 104.07 |
| IUPAC Name | (3E)-1,1,1-trideuterio-3-hydroxyiminobutan-2-one |
| SMILES | [2H]C([2H])([2H])C(=O)/C(C)=N/O |
| InChI | InChI=1S/C4H7NO2/c1-3(5-7)4(2)6/h7H,1-2H3/b5-3+/i2D3 |
| InChIKey | FSEUPUDHEBLWJY-ZEKNNAMCSA-N |
| XLogP | 0.43 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 104.12 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|