C3H3NaO3 — CID 131953163
sodium 3,3,3-trideuterio-2-oxopropanoate (PubChem CID 131953163) has the molecular formula C3H3NaO3 and a molecular weight of 113.06 g/mol. Its IUPAC name is sodium 3,3,3-trideuterio-2-oxopropanoate.
| Compound Name | sodium 3,3,3-trideuterio-2-oxopropanoate |
|---|---|
| PubChem CID | 131953163 |
| Molecular Formula | C3H3NaO3 |
| Molecular Weight | 113.06 g/mol |
| Exact Mass | 113.02 |
| IUPAC Name | sodium 3,3,3-trideuterio-2-oxopropanoate |
| SMILES | [2H]C([2H])([2H])C(=O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H4O3.Na/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1/i1D3; |
| InChIKey | DAEPDZWVDSPTHF-NIIDSAIPSA-M |
| XLogP | -4.67 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.06 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|