sodium tris(trimethylsilyl)silylformate

C10H27NaO2Si4 — CID 102393568

IUPACsodium tris(trimethylsilyl)silylformate
SMILESC[Si](C)(C)[Si](C(=O)[O-])([Si](C)(C)C)[Si](C)(C)C.[Na+]
InChIInChI=1S/C10H28O2Si4.Na/c1-13(2,3)16(10(11)12,14(4,5)6)15(7,8)9;/h1-9H3,(H,11,12);/q;+1/p-1
InChIKeyQCDWXURGFKCGPG-UHFFFAOYSA-M
MW314.66 g/mol
LogP-0.39
Rot. Bonds4

About sodium tris(trimethylsilyl)silylformate

sodium tris(trimethylsilyl)silylformate (PubChem CID 102393568) has the molecular formula C10H27NaO2Si4 and a molecular weight of 314.66 g/mol. Its IUPAC name is sodium tris(trimethylsilyl)silylformate.

Molecular Properties

Compound Namesodium tris(trimethylsilyl)silylformate
PubChem CID102393568
Molecular FormulaC10H27NaO2Si4
Molecular Weight314.66 g/mol
Exact Mass314.10
IUPAC Namesodium tris(trimethylsilyl)silylformate
SMILESC[Si](C)(C)[Si](C(=O)[O-])([Si](C)(C)C)[Si](C)(C)C.[Na+]
InChIInChI=1S/C10H28O2Si4.Na/c1-13(2,3)16(10(11)12,14(4,5)6)15(7,8)9;/h1-9H3,(H,11,12);/q;+1/p-1
InChIKeyQCDWXURGFKCGPG-UHFFFAOYSA-M
XLogP-0.39
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.66
LogP ≤ 5-0.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze sodium tris(trimethylsilyl)silylformate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium tris(trimethylsilyl)silylformate?
The IUPAC name of sodium tris(trimethylsilyl)silylformate (CID 102393568) is sodium tris(trimethylsilyl)silylformate.
What is the SMILES notation for sodium tris(trimethylsilyl)silylformate?
The canonical SMILES for sodium tris(trimethylsilyl)silylformate is C[Si](C)(C)[Si](C(=O)[O-])([Si](C)(C)C)[Si](C)(C)C.[Na+].
What is the InChIKey of sodium tris(trimethylsilyl)silylformate?
The InChIKey is QCDWXURGFKCGPG-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H28O2Si4.Na/c1-13(2,3)16(10(11)12,14(4,5)6)15(7,8)9;/h1-9H3,(H,11,12);/q;+1/p-1.
What are the key properties of sodium tris(trimethylsilyl)silylformate?
sodium tris(trimethylsilyl)silylformate has a molecular weight of 314.66 g/mol, XLogP of -0.39, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium tris(trimethylsilyl)silylformate is sourced from PubChem (CID 102393568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).