About sodium 2-trimethylsilylacetate
sodium 2-trimethylsilylacetate (PubChem CID 141466987) has the molecular formula C5H11NaO2Si
and a molecular weight of 154.22 g/mol. Its IUPAC name is sodium 2-trimethylsilylacetate.
Molecular Properties
| Compound Name | sodium 2-trimethylsilylacetate |
| PubChem CID | 141466987 |
| Molecular Formula | C5H11NaO2Si |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | sodium 2-trimethylsilylacetate |
| SMILES | C[Si](C)(C)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H12O2Si.Na/c1-8(2,3)4-5(6)7;/h4H2,1-3H3,(H,6,7);/q;+1/p-1 |
| InChIKey | GMPHSXLCSCHVKM-UHFFFAOYSA-M |
| XLogP | -2.92 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-trimethylsilylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-trimethylsilylacetate?
The IUPAC name of sodium 2-trimethylsilylacetate (CID 141466987) is sodium 2-trimethylsilylacetate.
What is the SMILES notation for sodium 2-trimethylsilylacetate?
The canonical SMILES for sodium 2-trimethylsilylacetate is C[Si](C)(C)CC(=O)[O-].[Na+].
What is the InChIKey of sodium 2-trimethylsilylacetate?
The InChIKey is GMPHSXLCSCHVKM-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H12O2Si.Na/c1-8(2,3)4-5(6)7;/h4H2,1-3H3,(H,6,7);/q;+1/p-1.
What are the key properties of sodium 2-trimethylsilylacetate?
sodium 2-trimethylsilylacetate has a molecular weight of 154.22 g/mol, XLogP of -2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-trimethylsilylacetate is sourced from PubChem (CID 141466987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).