C24H22BrClN4O3 — CID 137272179
N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5-[4-[(2-chlorophenyl)methoxy]phenyl]pyrazolidine-3-carboxamide (PubChem CID 137272179) has the molecular formula C24H22BrClN4O3 and a molecular weight of 529.82 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5-[4-[(2-chlorophenyl)methoxy]phenyl]pyrazolidine-3-carboxamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5-[4-[(2-chlorophenyl)methoxy]phenyl]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 137272179 |
| Molecular Formula | C24H22BrClN4O3 |
| Molecular Weight | 529.82 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-5-[4-[(2-chlorophenyl)methoxy]phenyl]pyrazolidine-3-carboxamide |
| SMILES | O=C(N/N=C/c1cc(Br)ccc1O)C1CC(c2ccc(OCc3ccccc3Cl)cc2)NN1 |
| InChI | InChI=1S/C24H22BrClN4O3/c25-18-7-10-23(31)17(11-18)13-27-30-24(32)22-12-21(28-29-22)15-5-8-19(9-6-15)33-14-16-3-1-2-4-20(16)26/h1-11,13,21-22,28-29,31H,12,14H2,(H,30,32)/b27-13+ |
| InChIKey | SOUIIRIWHYKKBN-UVHMKAGCSA-N |
| XLogP | 4.45 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|