C27H26ClN5O2 — CID 137272186
5-[4-[(4-chlorophenyl)methoxy]phenyl]-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]pyrazolidine-3-carboxamide (PubChem CID 137272186) has the molecular formula C27H26ClN5O2 and a molecular weight of 487.99 g/mol. Its IUPAC name is 5-[4-[(4-chlorophenyl)methoxy]phenyl]-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]pyrazolidine-3-carboxamide.
| Compound Name | 5-[4-[(4-chlorophenyl)methoxy]phenyl]-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 137272186 |
| Molecular Formula | C27H26ClN5O2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 5-[4-[(4-chlorophenyl)methoxy]phenyl]-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]pyrazolidine-3-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N/NC(=O)C1CC(c2ccc(OCc3ccc(Cl)cc3)cc2)NN1 |
| InChI | InChI=1S/C27H26ClN5O2/c1-17-23(22-4-2-3-5-24(22)30-17)15-29-33-27(34)26-14-25(31-32-26)19-8-12-21(13-9-19)35-16-18-6-10-20(28)11-7-18/h2-13,15,25-26,30-32H,14,16H2,1H3,(H,33,34)/b29-15+ |
| InChIKey | SUNGJJYTZZDGAD-WKULSOCRSA-N |
| XLogP | 4.77 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|