C14H16ClN5O — CID 137295628
N-[(E)-(2-chloro-1H-indol-3-yl)methylideneamino]-5-methylpyrazolidine-3-carboxamide (PubChem CID 137295628) has the molecular formula C14H16ClN5O and a molecular weight of 305.77 g/mol. Its IUPAC name is N-[(E)-(2-chloro-1H-indol-3-yl)methylideneamino]-5-methylpyrazolidine-3-carboxamide.
| Compound Name | N-[(E)-(2-chloro-1H-indol-3-yl)methylideneamino]-5-methylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 137295628 |
| Molecular Formula | C14H16ClN5O |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[(E)-(2-chloro-1H-indol-3-yl)methylideneamino]-5-methylpyrazolidine-3-carboxamide |
| SMILES | CC1CC(C(=O)N/N=C/c2c(Cl)[nH]c3ccccc23)NN1 |
| InChI | InChI=1S/C14H16ClN5O/c1-8-6-12(19-18-8)14(21)20-16-7-10-9-4-2-3-5-11(9)17-13(10)15/h2-5,7-8,12,17-19H,6H2,1H3,(H,20,21)/b16-7+ |
| InChIKey | IJSSINJDFJLCLZ-FRKPEAEDSA-N |
| XLogP | 1.53 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|