C12H15IN4O2 — CID 137295622
N-[(E)-(4-hydroxy-3-iodophenyl)methylideneamino]-5-methylpyrazolidine-3-carboxamide (PubChem CID 137295622) has the molecular formula C12H15IN4O2 and a molecular weight of 374.18 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3-iodophenyl)methylideneamino]-5-methylpyrazolidine-3-carboxamide.
| Compound Name | N-[(E)-(4-hydroxy-3-iodophenyl)methylideneamino]-5-methylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 137295622 |
| Molecular Formula | C12H15IN4O2 |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | N-[(E)-(4-hydroxy-3-iodophenyl)methylideneamino]-5-methylpyrazolidine-3-carboxamide |
| SMILES | CC1CC(C(=O)N/N=C/c2ccc(O)c(I)c2)NN1 |
| InChI | InChI=1S/C12H15IN4O2/c1-7-4-10(16-15-7)12(19)17-14-6-8-2-3-11(18)9(13)5-8/h2-3,5-7,10,15-16,18H,4H2,1H3,(H,17,19)/b14-6+ |
| InChIKey | NINMKSVCLVISMA-MKMNVTDBSA-N |
| XLogP | 0.70 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|