C18H24N4O3S — CID 135622933
1-ethylsulfonyl-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]piperidine-3-carboxamide (PubChem CID 135622933) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-ethylsulfonyl-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]piperidine-3-carboxamide.
| Compound Name | 1-ethylsulfonyl-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 135622933 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-ethylsulfonyl-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]piperidine-3-carboxamide |
| SMILES | CCS(=O)(=O)N1CCCC(C(=O)N/N=C/c2c(C)[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C18H24N4O3S/c1-3-26(24,25)22-10-6-7-14(12-22)18(23)21-19-11-16-13(2)20-17-9-5-4-8-15(16)17/h4-5,8-9,11,14,20H,3,6-7,10,12H2,1-2H3,(H,21,23)/b19-11+ |
| InChIKey | XYTWAGKEQBNJIR-YBFXNURJSA-N |
| XLogP | 1.99 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|