C18H22FN5O3S — CID 135621504
1-ethylsulfonyl-N-[(E)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]piperidine-3-carboxamide (PubChem CID 135621504) has the molecular formula C18H22FN5O3S and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-ethylsulfonyl-N-[(E)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]piperidine-3-carboxamide.
| Compound Name | 1-ethylsulfonyl-N-[(E)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 135621504 |
| Molecular Formula | C18H22FN5O3S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 1-ethylsulfonyl-N-[(E)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]piperidine-3-carboxamide |
| SMILES | CCS(=O)(=O)N1CCCC(C(=O)N/N=C/c2cn[nH]c2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H22FN5O3S/c1-2-28(26,27)24-9-3-4-14(12-24)18(25)23-21-11-15-10-20-22-17(15)13-5-7-16(19)8-6-13/h5-8,10-11,14H,2-4,9,12H2,1H3,(H,20,22)(H,23,25)/b21-11+ |
| InChIKey | YPLHJMCIELBTEF-SRZZPIQSSA-N |
| XLogP | 1.73 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|