C14H22N4O3S — CID 17087853
1-ethylsulfonyl-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]piperidine-3-carboxamide (PubChem CID 17087853) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is 1-ethylsulfonyl-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]piperidine-3-carboxamide.
| Compound Name | 1-ethylsulfonyl-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 17087853 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-ethylsulfonyl-N-[(E)-(1-methylpyrrol-2-yl)methylideneamino]piperidine-3-carboxamide |
| SMILES | CCS(=O)(=O)N1CCCC(C(=O)N/N=C/c2cccn2C)C1 |
| InChI | InChI=1S/C14H22N4O3S/c1-3-22(20,21)18-9-4-6-12(11-18)14(19)16-15-10-13-7-5-8-17(13)2/h5,7-8,10,12H,3-4,6,9,11H2,1-2H3,(H,16,19)/b15-10+ |
| InChIKey | HGFSTTKNVSTQCX-XNTDXEJSSA-N |
| XLogP | 0.54 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|