C7H11ClN4O2 — CID 137273201
4-[(3-amino-2-hydroxypropyl)amino]-5-chloro-1H-pyrimidin-6-one (PubChem CID 137273201) has the molecular formula C7H11ClN4O2 and a molecular weight of 218.64 g/mol. Its IUPAC name is 4-[(3-amino-2-hydroxypropyl)amino]-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-[(3-amino-2-hydroxypropyl)amino]-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137273201 |
| Molecular Formula | C7H11ClN4O2 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 4-[(3-amino-2-hydroxypropyl)amino]-5-chloro-1H-pyrimidin-6-one |
| SMILES | NCC(O)CNc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C7H11ClN4O2/c8-5-6(10-2-4(13)1-9)11-3-12-7(5)14/h3-4,13H,1-2,9H2,(H2,10,11,12,14) |
| InChIKey | YVHQOMSGVZWPNO-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |