C17H11ClN2O2S — CID 137274552
8-chloro-2-(4-methoxyphenyl)-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 137274552) has the molecular formula C17H11ClN2O2S and a molecular weight of 342.81 g/mol. Its IUPAC name is 8-chloro-2-(4-methoxyphenyl)-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
| Compound Name | 8-chloro-2-(4-methoxyphenyl)-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137274552 |
| Molecular Formula | C17H11ClN2O2S |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 8-chloro-2-(4-methoxyphenyl)-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | COc1ccc(-c2nc3c(sc4ccc(Cl)cc43)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C17H11ClN2O2S/c1-22-11-5-2-9(3-6-11)16-19-14-12-8-10(18)4-7-13(12)23-15(14)17(21)20-16/h2-8H,1H3,(H,19,20,21) |
| InChIKey | YFAPPIKULSHUDZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |