C14H10ClIN2OS — CID 137277833
5-(4-chlorophenyl)-7-iodo-6-methyl-1,3-dihydrothieno[2,3-e][1,4]diazepin-2-one (PubChem CID 137277833) has the molecular formula C14H10ClIN2OS and a molecular weight of 416.67 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-7-iodo-6-methyl-1,3-dihydrothieno[2,3-e][1,4]diazepin-2-one.
| Compound Name | 5-(4-chlorophenyl)-7-iodo-6-methyl-1,3-dihydrothieno[2,3-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 137277833 |
| Molecular Formula | C14H10ClIN2OS |
| Molecular Weight | 416.67 g/mol |
| Exact Mass | 415.92 |
| IUPAC Name | 5-(4-chlorophenyl)-7-iodo-6-methyl-1,3-dihydrothieno[2,3-e][1,4]diazepin-2-one |
| SMILES | Cc1c(I)sc2c1C(c1ccc(Cl)cc1)=NCC(=O)N2 |
| InChI | InChI=1S/C14H10ClIN2OS/c1-7-11-12(8-2-4-9(15)5-3-8)17-6-10(19)18-14(11)20-13(7)16/h2-5H,6H2,1H3,(H,18,19) |
| InChIKey | FKSLNVNGASVBNQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|