C10H17N3O — CID 137278545
(NZ)-N-[(1S,3Z,4R)-3-hydrazinylidene-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 137278545) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is (NZ)-N-[(1S,3Z,4R)-3-hydrazinylidene-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,3Z,4R)-3-hydrazinylidene-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 137278545 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (NZ)-N-[(1S,3Z,4R)-3-hydrazinylidene-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C(=N/N)/C2=N\O |
| InChI | InChI=1S/C10H17N3O/c1-9(2)6-4-5-10(9,3)8(12-11)7(6)13-14/h6,14H,4-5,11H2,1-3H3/b12-8+,13-7-/t6-,10+/m1/s1 |
| InChIKey | HNXWGANWYXNUFH-URWAKRRISA-N |
| XLogP | 1.59 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|