C10H12N5O12P3S2-4 — CID 137279646
[[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-sulfidophosphinothioyl]oxy-oxidophosphoryl] phosphate (PubChem CID 137279646) has the molecular formula C10H12N5O12P3S2-4 and a molecular weight of 551.29 g/mol. Its IUPAC name is [[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-sulfidophosphinothioyl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-sulfidophosphinothioyl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 137279646 |
| Molecular Formula | C10H12N5O12P3S2-4 |
| Molecular Weight | 551.29 g/mol |
| Exact Mass | 550.92 |
| IUPAC Name | [[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-sulfidophosphinothioyl]oxy-oxidophosphoryl] phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=S)([S-])OP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N5O12P3S2/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(25-9)1-24-30(31,32)27-29(22,23)26-28(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H,31,32)(H2,19,20,21)(H3,11,13,14,18)/p-4/t3-,5-,6-,9-/m1/s1 |
| InChIKey | KEXPLTPUOCOSNM-UUOKFMHZSA-J |
| XLogP | -3.56 |
| TPSA | 270.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.29 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|