C21H23N5O4S — CID 137281733
3-cyclopropyl-3-[4-oxo-3-[[(2S,3R)-1,1,3-trihydroxy-2-methyl-2,3-dihydro-1-benzothiophen-5-yl]amino]-5H-pyrazolo[4,3-c]pyridin-1-yl]propanenitrile (PubChem CID 137281733) has the molecular formula C21H23N5O4S and a molecular weight of 441.51 g/mol. Its IUPAC name is 3-cyclopropyl-3-[4-oxo-3-[[(2S,3R)-1,1,3-trihydroxy-2-methyl-2,3-dihydro-1-benzothiophen-5-yl]amino]-5H-pyrazolo[4,3-c]pyridin-1-yl]propanenitrile.
| Compound Name | 3-cyclopropyl-3-[4-oxo-3-[[(2S,3R)-1,1,3-trihydroxy-2-methyl-2,3-dihydro-1-benzothiophen-5-yl]amino]-5H-pyrazolo[4,3-c]pyridin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 137281733 |
| Molecular Formula | C21H23N5O4S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 3-cyclopropyl-3-[4-oxo-3-[[(2S,3R)-1,1,3-trihydroxy-2-methyl-2,3-dihydro-1-benzothiophen-5-yl]amino]-5H-pyrazolo[4,3-c]pyridin-1-yl]propanenitrile |
| SMILES | C[C@H]1[C@H](O)c2cc(Nc3nn(C(CC#N)C4CC4)c4cc[nH]c(=O)c34)ccc2S1(O)O |
| InChI | InChI=1S/C21H23N5O4S/c1-11-19(27)14-10-13(4-5-17(14)31(11,29)30)24-20-18-16(7-9-23-21(18)28)26(25-20)15(6-8-22)12-2-3-12/h4-5,7,9-12,15,19,27,29-30H,2-3,6H2,1H3,(H,23,28)(H,24,25)/t11-,15?,19-/m0/s1 |
| InChIKey | MVVRMVHXVIFAGZ-WCFQSHCHSA-N |
| XLogP | 3.88 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |