C22H23N5O3S — CID 137281786
(3S)-3-cyclopropyl-3-[3-[[(2S,3R)-2,3-dimethyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl]amino]-4-oxo-5H-pyrazolo[4,3-c]pyridin-1-yl]propanenitrile (PubChem CID 137281786) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is (3S)-3-cyclopropyl-3-[3-[[(2S,3R)-2,3-dimethyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl]amino]-4-oxo-5H-pyrazolo[4,3-c]pyridin-1-yl]propanenitrile.
| Compound Name | (3S)-3-cyclopropyl-3-[3-[[(2S,3R)-2,3-dimethyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl]amino]-4-oxo-5H-pyrazolo[4,3-c]pyridin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 137281786 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (3S)-3-cyclopropyl-3-[3-[[(2S,3R)-2,3-dimethyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl]amino]-4-oxo-5H-pyrazolo[4,3-c]pyridin-1-yl]propanenitrile |
| SMILES | C[C@@H]1c2cc(Nc3nn([C@@H](CC#N)C4CC4)c4cc[nH]c(=O)c34)ccc2S(=O)(=O)[C@H]1C |
| InChI | InChI=1S/C22H23N5O3S/c1-12-13(2)31(29,30)19-6-5-15(11-16(12)19)25-21-20-18(8-10-24-22(20)28)27(26-21)17(7-9-23)14-3-4-14/h5-6,8,10-14,17H,3-4,7H2,1-2H3,(H,24,28)(H,25,26)/t12-,13-,17-/m0/s1 |
| InChIKey | RVHQDSWXQRKGJQ-DCGLDWPTSA-N |
| XLogP | 3.61 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |