C22H25N5O5 — CID 137282994
1-[2-(4-methoxyphenyl)-1-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]-3-(4-morpholin-4-ylphenyl)urea (PubChem CID 137282994) has the molecular formula C22H25N5O5 and a molecular weight of 439.47 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)-1-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]-3-(4-morpholin-4-ylphenyl)urea.
| Compound Name | 1-[2-(4-methoxyphenyl)-1-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]-3-(4-morpholin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 137282994 |
| Molecular Formula | C22H25N5O5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)-1-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]-3-(4-morpholin-4-ylphenyl)urea |
| SMILES | COc1ccc(CC(NC(=O)Nc2ccc(N3CCOCC3)cc2)c2noc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C22H25N5O5/c1-30-18-8-2-15(3-9-18)14-19(20-25-22(29)32-26-20)24-21(28)23-16-4-6-17(7-5-16)27-10-12-31-13-11-27/h2-9,19H,10-14H2,1H3,(H2,23,24,28)(H,25,26,29) |
| InChIKey | RCAVWFHISYWHHJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|