C30H33N7O — CID 137284328
cyclopentyl-[[5-[3-(4-piperidin-1-yl-1H-indol-2-yl)-2H-pyrazolo[3,4-b]pyridin-5-yl]-3-pyridinyl]amino]methanol (PubChem CID 137284328) has the molecular formula C30H33N7O and a molecular weight of 507.64 g/mol. Its IUPAC name is cyclopentyl-[[5-[3-(4-piperidin-1-yl-1H-indol-2-yl)-2H-pyrazolo[3,4-b]pyridin-5-yl]-3-pyridinyl]amino]methanol.
| Compound Name | cyclopentyl-[[5-[3-(4-piperidin-1-yl-1H-indol-2-yl)-2H-pyrazolo[3,4-b]pyridin-5-yl]-3-pyridinyl]amino]methanol |
|---|---|
| PubChem CID | 137284328 |
| Molecular Formula | C30H33N7O |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | cyclopentyl-[[5-[3-(4-piperidin-1-yl-1H-indol-2-yl)-2H-pyrazolo[3,4-b]pyridin-5-yl]-3-pyridinyl]amino]methanol |
| SMILES | OC(Nc1cncc(-c2cnc3n[nH]c(-c4cc5c(N6CCCCC6)cccc5[nH]4)c3c2)c1)C1CCCC1 |
| InChI | InChI=1S/C30H33N7O/c38-30(19-7-2-3-8-19)33-22-13-20(16-31-18-22)21-14-24-28(35-36-29(24)32-17-21)26-15-23-25(34-26)9-6-10-27(23)37-11-4-1-5-12-37/h6,9-10,13-19,30,33-34,38H,1-5,7-8,11-12H2,(H,32,35,36) |
| InChIKey | HCQVGCDKWWFFNY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|