C30H28N6OS — CID 137284340
cyclohexyl-[[5-[3-(4-thiophen-2-yl-1H-indol-2-yl)-2H-pyrazolo[3,4-b]pyridin-5-yl]-3-pyridinyl]amino]methanol (PubChem CID 137284340) has the molecular formula C30H28N6OS and a molecular weight of 520.66 g/mol. Its IUPAC name is cyclohexyl-[[5-[3-(4-thiophen-2-yl-1H-indol-2-yl)-2H-pyrazolo[3,4-b]pyridin-5-yl]-3-pyridinyl]amino]methanol.
| Compound Name | cyclohexyl-[[5-[3-(4-thiophen-2-yl-1H-indol-2-yl)-2H-pyrazolo[3,4-b]pyridin-5-yl]-3-pyridinyl]amino]methanol |
|---|---|
| PubChem CID | 137284340 |
| Molecular Formula | C30H28N6OS |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | cyclohexyl-[[5-[3-(4-thiophen-2-yl-1H-indol-2-yl)-2H-pyrazolo[3,4-b]pyridin-5-yl]-3-pyridinyl]amino]methanol |
| SMILES | OC(Nc1cncc(-c2cnc3n[nH]c(-c4cc5c(-c6cccs6)cccc5[nH]4)c3c2)c1)C1CCCCC1 |
| InChI | InChI=1S/C30H28N6OS/c37-30(18-6-2-1-3-7-18)33-21-12-19(15-31-17-21)20-13-24-28(35-36-29(24)32-16-20)26-14-23-22(27-10-5-11-38-27)8-4-9-25(23)34-26/h4-5,8-18,30,33-34,37H,1-3,6-7H2,(H,32,35,36) |
| InChIKey | ACPIUZIVLXPTBK-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|