C16H24N6O13P2-2 — CID 137284877
[[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2S,4R)-3,4-dihydroxy-5-methylpyrrolidin-2-yl]methyl phosphate (PubChem CID 137284877) has the molecular formula C16H24N6O13P2-2 and a molecular weight of 570.35 g/mol. Its IUPAC name is [[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2S,4R)-3,4-dihydroxy-5-methylpyrrolidin-2-yl]methyl phosphate.
| Compound Name | [[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2S,4R)-3,4-dihydroxy-5-methylpyrrolidin-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 137284877 |
| Molecular Formula | C16H24N6O13P2-2 |
| Molecular Weight | 570.35 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | [[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2S,4R)-3,4-dihydroxy-5-methylpyrrolidin-2-yl]methyl phosphate |
| SMILES | CC1N[C@@H](COP(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)C(O)C2O)C(O)[C@@H]1O |
| InChI | InChI=1S/C16H26N6O13P2/c1-5-9(23)10(24)6(19-5)2-32-36(28,29)35-37(30,31)33-3-7-11(25)12(26)15(34-7)22-4-18-8-13(22)20-16(17)21-14(8)27/h4-7,9-12,15,19,23-26H,2-3H2,1H3,(H,28,29)(H,30,31)(H3,17,20,21,27)/p-2/t5?,6-,7+,9+,10?,11?,12?,15+/m0/s1 |
| InChIKey | QYHZMOGBCRKXMU-UBJDEQHTSA-L |
| XLogP | -4.61 |
| TPSA | 299.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.35 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|