C13H15N7Na2O10P2 — CID 169016900
disodium;[[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-imidazol-1-ylphosphinate (PubChem CID 169016900) has the molecular formula C13H15N7Na2O10P2 and a molecular weight of 537.23 g/mol. Its IUPAC name is disodium;[[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-imidazol-1-ylphosphinate.
| Compound Name | disodium;[[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-imidazol-1-ylphosphinate |
|---|---|
| PubChem CID | 169016900 |
| Molecular Formula | C13H15N7Na2O10P2 |
| Molecular Weight | 537.23 g/mol |
| Exact Mass | 537.02 |
| IUPAC Name | disodium;[[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-imidazol-1-ylphosphinate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])n3ccnc3)C(O)[C@@H]2O)c(=O)[nH]1.[Na+].[Na+] |
| InChI | InChI=1S/C13H17N7O10P2.2Na/c14-13-17-10-7(11(23)18-13)16-5-20(10)12-9(22)8(21)6(29-12)3-28-32(26,27)30-31(24,25)19-2-1-15-4-19;;/h1-2,4-6,8-9,12,21-22H,3H2,(H,24,25)(H,26,27)(H3,14,17,18,23);;/q;2*+1/p-2/t6-,8?,9+,12-;;/m1../s1 |
| InChIKey | NLJLFSUCHFQBLU-VLZSEABOSA-L |
| XLogP | -8.96 |
| TPSA | 255.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.23 |
| LogP ≤ 5 | -8.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|