C19H13N3O2S2 — CID 137285398
2-(furan-2-ylmethyl)-6,8-dithiophen-2-ylimidazo[1,2-a]pyrazin-3-ol (PubChem CID 137285398) has the molecular formula C19H13N3O2S2 and a molecular weight of 379.47 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-6,8-dithiophen-2-ylimidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 2-(furan-2-ylmethyl)-6,8-dithiophen-2-ylimidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 137285398 |
| Molecular Formula | C19H13N3O2S2 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 2-(furan-2-ylmethyl)-6,8-dithiophen-2-ylimidazo[1,2-a]pyrazin-3-ol |
| SMILES | Oc1c(Cc2ccco2)nc2c(-c3cccs3)nc(-c3cccs3)cn12 |
| InChI | InChI=1S/C19H13N3O2S2/c23-19-13(10-12-4-1-7-24-12)21-18-17(16-6-3-9-26-16)20-14(11-22(18)19)15-5-2-8-25-15/h1-9,11,23H,10H2 |
| InChIKey | FHIQZWLRSPZXDB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 63.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |