C29H21N7OS — CID 137286962
phenyl-[[5-[3-(7-thiophen-3-yl-3H-imidazo[4,5-c]pyridin-2-yl)-1H-indazol-5-yl]-3-pyridinyl]amino]methanol (PubChem CID 137286962) has the molecular formula C29H21N7OS and a molecular weight of 515.60 g/mol. Its IUPAC name is phenyl-[[5-[3-(7-thiophen-3-yl-3H-imidazo[4,5-c]pyridin-2-yl)-1H-indazol-5-yl]-3-pyridinyl]amino]methanol.
| Compound Name | phenyl-[[5-[3-(7-thiophen-3-yl-3H-imidazo[4,5-c]pyridin-2-yl)-1H-indazol-5-yl]-3-pyridinyl]amino]methanol |
|---|---|
| PubChem CID | 137286962 |
| Molecular Formula | C29H21N7OS |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | phenyl-[[5-[3-(7-thiophen-3-yl-3H-imidazo[4,5-c]pyridin-2-yl)-1H-indazol-5-yl]-3-pyridinyl]amino]methanol |
| SMILES | OC(Nc1cncc(-c2ccc3[nH]nc(-c4nc5c(-c6ccsc6)cncc5[nH]4)c3c2)c1)c1ccccc1 |
| InChI | InChI=1S/C29H21N7OS/c37-29(17-4-2-1-3-5-17)32-21-10-20(12-30-13-21)18-6-7-24-22(11-18)27(36-35-24)28-33-25-15-31-14-23(26(25)34-28)19-8-9-38-16-19/h1-16,29,32,37H,(H,33,34)(H,35,36) |
| InChIKey | PXQLVUQVCHTZQX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|