C28H23FN8O — CID 137287319
cyclobutyl-[[5-[7-fluoro-3-(7-pyridin-3-yl-1H-imidazo[4,5-b]pyridin-2-yl)-2H-indazol-5-yl]-3-pyridinyl]amino]methanol (PubChem CID 137287319) has the molecular formula C28H23FN8O and a molecular weight of 506.55 g/mol. Its IUPAC name is cyclobutyl-[[5-[7-fluoro-3-(7-pyridin-3-yl-1H-imidazo[4,5-b]pyridin-2-yl)-2H-indazol-5-yl]-3-pyridinyl]amino]methanol.
| Compound Name | cyclobutyl-[[5-[7-fluoro-3-(7-pyridin-3-yl-1H-imidazo[4,5-b]pyridin-2-yl)-2H-indazol-5-yl]-3-pyridinyl]amino]methanol |
|---|---|
| PubChem CID | 137287319 |
| Molecular Formula | C28H23FN8O |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | cyclobutyl-[[5-[7-fluoro-3-(7-pyridin-3-yl-1H-imidazo[4,5-b]pyridin-2-yl)-2H-indazol-5-yl]-3-pyridinyl]amino]methanol |
| SMILES | OC(Nc1cncc(-c2cc(F)c3n[nH]c(-c4nc5nccc(-c6cccnc6)c5[nH]4)c3c2)c1)C1CCC1 |
| InChI | InChI=1S/C28H23FN8O/c29-22-11-17(18-9-19(14-31-13-18)33-28(38)15-3-1-4-15)10-21-23(22)36-37-25(21)27-34-24-20(6-8-32-26(24)35-27)16-5-2-7-30-12-16/h2,5-15,28,33,38H,1,3-4H2,(H,36,37)(H,32,34,35) |
| InChIKey | JYDGRWDYXJJMSF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|