C29H20FN7O2 — CID 137316559
[[5-[7-fluoro-3-[7-(furan-3-yl)-1H-imidazo[4,5-b]pyridin-2-yl]-2H-indazol-5-yl]-3-pyridinyl]amino]-phenylmethanol (PubChem CID 137316559) has the molecular formula C29H20FN7O2 and a molecular weight of 517.52 g/mol. Its IUPAC name is [[5-[7-fluoro-3-[7-(furan-3-yl)-1H-imidazo[4,5-b]pyridin-2-yl]-2H-indazol-5-yl]-3-pyridinyl]amino]-phenylmethanol.
| Compound Name | [[5-[7-fluoro-3-[7-(furan-3-yl)-1H-imidazo[4,5-b]pyridin-2-yl]-2H-indazol-5-yl]-3-pyridinyl]amino]-phenylmethanol |
|---|---|
| PubChem CID | 137316559 |
| Molecular Formula | C29H20FN7O2 |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | [[5-[7-fluoro-3-[7-(furan-3-yl)-1H-imidazo[4,5-b]pyridin-2-yl]-2H-indazol-5-yl]-3-pyridinyl]amino]-phenylmethanol |
| SMILES | OC(Nc1cncc(-c2cc(F)c3n[nH]c(-c4nc5nccc(-c6ccoc6)c5[nH]4)c3c2)c1)c1ccccc1 |
| InChI | InChI=1S/C29H20FN7O2/c30-23-12-18(19-10-20(14-31-13-19)33-29(38)16-4-2-1-3-5-16)11-22-24(23)36-37-26(22)28-34-25-21(17-7-9-39-15-17)6-8-32-27(25)35-28/h1-15,29,33,38H,(H,36,37)(H,32,34,35) |
| InChIKey | ZJLBREWONXPUTF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|