C23H30N6O4 — CID 137289868
1-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 137289868) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 1-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 137289868 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 1-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | CCOc1ccc(CN2CCC(C(=O)NO)CC2)cc1-c1nc2c(CC)nn(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C23H30N6O4/c1-4-17-19-20(28(3)26-17)23(31)25-21(24-19)16-12-14(6-7-18(16)33-5-2)13-29-10-8-15(9-11-29)22(30)27-32/h6-7,12,15,32H,4-5,8-11,13H2,1-3H3,(H,27,30)(H,24,25,31) |
| InChIKey | DUIWLMFQGKXCSX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|