C21H19N3O5 — CID 137295578
2,5-dihydroxy-6-[(4-methoxyphenyl)diazenyl]-3-(2-methylanilino)benzoic acid (PubChem CID 137295578) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2,5-dihydroxy-6-[(4-methoxyphenyl)diazenyl]-3-(2-methylanilino)benzoic acid.
| Compound Name | 2,5-dihydroxy-6-[(4-methoxyphenyl)diazenyl]-3-(2-methylanilino)benzoic acid |
|---|---|
| PubChem CID | 137295578 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2,5-dihydroxy-6-[(4-methoxyphenyl)diazenyl]-3-(2-methylanilino)benzoic acid |
| SMILES | COc1ccc(/N=N/c2c(O)cc(Nc3ccccc3C)c(O)c2C(=O)O)cc1 |
| InChI | InChI=1S/C21H19N3O5/c1-12-5-3-4-6-15(12)22-16-11-17(25)19(18(20(16)26)21(27)28)24-23-13-7-9-14(29-2)10-8-13/h3-11,22,25-26H,1-2H3,(H,27,28)/b24-23+ |
| InChIKey | GBRQLGRSELAZHB-WCWDXBQESA-N |
| XLogP | 5.27 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|