C30H26ClFN4O2 — CID 137297899
1-[4-[7-chloro-4-(2-cyclopropylphenyl)-6-(2-fluoro-6-hydroxyphenyl)phthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 137297899) has the molecular formula C30H26ClFN4O2 and a molecular weight of 529.02 g/mol. Its IUPAC name is 1-[4-[7-chloro-4-(2-cyclopropylphenyl)-6-(2-fluoro-6-hydroxyphenyl)phthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-chloro-4-(2-cyclopropylphenyl)-6-(2-fluoro-6-hydroxyphenyl)phthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 137297899 |
| Molecular Formula | C30H26ClFN4O2 |
| Molecular Weight | 529.02 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 1-[4-[7-chloro-4-(2-cyclopropylphenyl)-6-(2-fluoro-6-hydroxyphenyl)phthalazin-1-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nnc(-c3ccccc3C3CC3)c3cc(-c4c(O)cccc4F)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C30H26ClFN4O2/c1-2-27(38)35-12-14-36(15-13-35)30-22-17-24(31)23(28-25(32)8-5-9-26(28)37)16-21(22)29(33-34-30)20-7-4-3-6-19(20)18-10-11-18/h2-9,16-18,37H,1,10-15H2 |
| InChIKey | ORTQIMYECIPGED-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.02 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|