C21H19FN4O — CID 137298681
3-[[4-(6-fluoro-4-oxo-3H-quinazolin-2-yl)piperidin-1-yl]methyl]benzonitrile (PubChem CID 137298681) has the molecular formula C21H19FN4O and a molecular weight of 362.41 g/mol. Its IUPAC name is 3-[[4-(6-fluoro-4-oxo-3H-quinazolin-2-yl)piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-(6-fluoro-4-oxo-3H-quinazolin-2-yl)piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 137298681 |
| Molecular Formula | C21H19FN4O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 3-[[4-(6-fluoro-4-oxo-3H-quinazolin-2-yl)piperidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CCC(c3nc4ccc(F)cc4c(=O)[nH]3)CC2)c1 |
| InChI | InChI=1S/C21H19FN4O/c22-17-4-5-19-18(11-17)21(27)25-20(24-19)16-6-8-26(9-7-16)13-15-3-1-2-14(10-15)12-23/h1-5,10-11,16H,6-9,13H2,(H,24,25,27) |
| InChIKey | SNGIRVUQIOHYFF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |