C25H25N3OS — CID 137298684
6-methyl-2-[1-[(3-thiophen-3-ylphenyl)methyl]piperidin-4-yl]-3H-quinazolin-4-one (PubChem CID 137298684) has the molecular formula C25H25N3OS and a molecular weight of 415.56 g/mol. Its IUPAC name is 6-methyl-2-[1-[(3-thiophen-3-ylphenyl)methyl]piperidin-4-yl]-3H-quinazolin-4-one.
| Compound Name | 6-methyl-2-[1-[(3-thiophen-3-ylphenyl)methyl]piperidin-4-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137298684 |
| Molecular Formula | C25H25N3OS |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 6-methyl-2-[1-[(3-thiophen-3-ylphenyl)methyl]piperidin-4-yl]-3H-quinazolin-4-one |
| SMILES | Cc1ccc2nc(C3CCN(Cc4cccc(-c5ccsc5)c4)CC3)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C25H25N3OS/c1-17-5-6-23-22(13-17)25(29)27-24(26-23)19-7-10-28(11-8-19)15-18-3-2-4-20(14-18)21-9-12-30-16-21/h2-6,9,12-14,16,19H,7-8,10-11,15H2,1H3,(H,26,27,29) |
| InChIKey | OMKQPTHHYAEVSF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |