C21H21F3N4O4S — CID 137299529
CID 137299529 (PubChem CID 137299529) has the molecular formula C21H21F3N4O4S and a molecular weight of 482.48 g/mol.
| Compound Name | CID 137299529 |
|---|---|
| PubChem CID | 137299529 |
| Molecular Formula | C21H21F3N4O4S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | — |
| SMILES | COc1ccc(-n2nc(C3CCCN([S+](=O)([O-])c4cccc(C(F)(F)F)c4)C3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H21F3N4O4S/c1-32-17-9-7-16(8-10-17)28-20(29)25-19(26-28)14-4-3-11-27(13-14)33(30,31)18-6-2-5-15(12-18)21(22,23)24/h2,5-10,12,14H,3-4,11,13H2,1H3,(H-,25,26,29,30,31) |
| InChIKey | XHTANUIYFKPBBI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|