C35H36N3OS3+ — CID 137300685
(2E,5E)-3-ethyl-2-[(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)methylidene]-5-[(2E)-2-(3-ethyl-5-methyl-3a,7a-dihydro-1,3-benzothiazol-2-ylidene)ethylidene]-1,3-thiazolidin-4-one (PubChem CID 137300685) has the molecular formula C35H36N3OS3+ and a molecular weight of 610.89 g/mol. Its IUPAC name is (2E,5E)-3-ethyl-2-[(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)methylidene]-5-[(2E)-2-(3-ethyl-5-methyl-3a,7a-dihydro-1,3-benzothiazol-2-ylidene)ethylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-3-ethyl-2-[(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)methylidene]-5-[(2E)-2-(3-ethyl-5-methyl-3a,7a-dihydro-1,3-benzothiazol-2-ylidene)ethylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137300685 |
| Molecular Formula | C35H36N3OS3+ |
| Molecular Weight | 610.89 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | (2E,5E)-3-ethyl-2-[(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)methylidene]-5-[(2E)-2-(3-ethyl-5-methyl-3a,7a-dihydro-1,3-benzothiazol-2-ylidene)ethylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1/C(=C\C=c2\s/c(=C/c3sc(-c4ccccc4)c(-c4ccccc4)[n+]3CC)n(CC)c2=O)SC2C=CC(C)=CC21 |
| InChI | InChI=1S/C35H36N3OS3/c1-5-36-27-22-24(4)18-19-28(27)40-30(36)21-20-29-35(39)38(7-3)32(41-29)23-31-37(6-2)33(25-14-10-8-11-15-25)34(42-31)26-16-12-9-13-17-26/h8-23,27-28H,5-7H2,1-4H3/q+1/b29-20+,30-21+ |
| InChIKey | QAFGILYJSZWCKR-RZEGEWEPSA-N |
| XLogP | 6.41 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.89 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|