C32H31N3O2S4 — CID 135794695
3-butyl-5-[[(2E)-2-[(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-4-olate (PubChem CID 135794695) has the molecular formula C32H31N3O2S4 and a molecular weight of 617.89 g/mol. Its IUPAC name is 3-butyl-5-[[(2E)-2-[(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-4-olate.
| Compound Name | 3-butyl-5-[[(2E)-2-[(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-4-olate |
|---|---|
| PubChem CID | 135794695 |
| Molecular Formula | C32H31N3O2S4 |
| Molecular Weight | 617.89 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | 3-butyl-5-[[(2E)-2-[(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-4-olate |
| SMILES | C=CCn1c(=O)c(=Cc2sc(=S)n(CCCC)c2[O-])s/c1=C/c1sc(-c2ccccc2)c(-c2ccccc2)[n+]1CC |
| InChI | InChI=1S/C32H31N3O2S4/c1-4-7-19-35-31(37)25(40-32(35)38)20-24-30(36)34(18-5-2)27(39-24)21-26-33(6-3)28(22-14-10-8-11-15-22)29(41-26)23-16-12-9-13-17-23/h5,8-17,20-21H,2,4,6-7,18-19H2,1,3H3 |
| InChIKey | NTBZWDMQCYLBDY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 53.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.89 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|