C39H38N3O4S3+ — CID 165366187
4-[2-[(E)-[5-[2-(1-ethylquinolin-4-ylidene)ethylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]methyl]-4,5-diphenyl-1,3-thiazol-3-ium-3-yl]butane-1-sulfonic acid (PubChem CID 165366187) has the molecular formula C39H38N3O4S3+ and a molecular weight of 708.95 g/mol. Its IUPAC name is 4-[2-[(E)-[5-[2-(1-ethylquinolin-4-ylidene)ethylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]methyl]-4,5-diphenyl-1,3-thiazol-3-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[(E)-[5-[2-(1-ethylquinolin-4-ylidene)ethylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]methyl]-4,5-diphenyl-1,3-thiazol-3-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 165366187 |
| Molecular Formula | C39H38N3O4S3+ |
| Molecular Weight | 708.95 g/mol |
| Exact Mass | 708.20 |
| IUPAC Name | 4-[2-[(E)-[5-[2-(1-ethylquinolin-4-ylidene)ethylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]methyl]-4,5-diphenyl-1,3-thiazol-3-ium-3-yl]butane-1-sulfonic acid |
| SMILES | C=CCn1c(=O)c(=CC=C2C=CN(CC)c3ccccc32)s/c1=C/c1sc(-c2ccccc2)c(-c2ccccc2)[n+]1CCCCS(=O)(=O)O |
| InChI | InChI=1S/C39H37N3O4S3/c1-3-24-42-36(47-34(39(42)43)22-21-29-23-26-40(4-2)33-20-12-11-19-32(29)33)28-35-41(25-13-14-27-49(44,45)46)37(30-15-7-5-8-16-30)38(48-35)31-17-9-6-10-18-31/h3,5-12,15-23,26,28H,1,4,13-14,24-25,27H2,2H3/p+1 |
| InChIKey | NGFPKWMJFUXGDD-UHFFFAOYSA-O |
| XLogP | 6.49 |
| TPSA | 83.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.95 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|