C36H36N3OS2+ — CID 98298222
(2E,5E)-3-ethyl-2-[[(4S,5S)-3-ethyl-4,5-diphenyl-4,5-dihydro-1,3-thiazol-3-ium-2-yl]methylidene]-5-[(2E)-2-(1-ethylquinolin-4-ylidene)ethylidene]-1,3-thiazolidin-4-one (PubChem CID 98298222) has the molecular formula C36H36N3OS2+ and a molecular weight of 590.84 g/mol. Its IUPAC name is (2E,5E)-3-ethyl-2-[[(4S,5S)-3-ethyl-4,5-diphenyl-4,5-dihydro-1,3-thiazol-3-ium-2-yl]methylidene]-5-[(2E)-2-(1-ethylquinolin-4-ylidene)ethylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-3-ethyl-2-[[(4S,5S)-3-ethyl-4,5-diphenyl-4,5-dihydro-1,3-thiazol-3-ium-2-yl]methylidene]-5-[(2E)-2-(1-ethylquinolin-4-ylidene)ethylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 98298222 |
| Molecular Formula | C36H36N3OS2+ |
| Molecular Weight | 590.84 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | (2E,5E)-3-ethyl-2-[[(4S,5S)-3-ethyl-4,5-diphenyl-4,5-dihydro-1,3-thiazol-3-ium-2-yl]methylidene]-5-[(2E)-2-(1-ethylquinolin-4-ylidene)ethylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C=C/C(=C\C=c2\s/c(=C/C3=[N+](CC)[C@@H](c4ccccc4)[C@H](c4ccccc4)S3)n(CC)c2=O)c2ccccc21 |
| InChI | InChI=1S/C36H36N3OS2/c1-4-37-24-23-26(29-19-13-14-20-30(29)37)21-22-31-36(40)39(6-3)33(41-31)25-32-38(5-2)34(27-15-9-7-10-16-27)35(42-32)28-17-11-8-12-18-28/h7-25,34-35H,4-6H2,1-3H3/q+1/b26-21+,31-22+/t34-,35-/m0/s1 |
| InChIKey | YKALLQKRNOWIGO-VXTBSYIZSA-N |
| XLogP | 6.59 |
| TPSA | 28.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.84 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|