C32H27N3O3 — CID 137302771
9H-fluoren-9-ylmethyl N-[(2S)-4-diazo-3-oxo-1,1-diphenylpentan-2-yl]carbamate (PubChem CID 137302771) has the molecular formula C32H27N3O3 and a molecular weight of 501.59 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-4-diazo-3-oxo-1,1-diphenylpentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-4-diazo-3-oxo-1,1-diphenylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 137302771 |
| Molecular Formula | C32H27N3O3 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-4-diazo-3-oxo-1,1-diphenylpentan-2-yl]carbamate |
| SMILES | CC(=[N+]=[N-])C(=O)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H27N3O3/c1-21(35-33)31(36)30(29(22-12-4-2-5-13-22)23-14-6-3-7-15-23)34-32(37)38-20-28-26-18-10-8-16-24(26)25-17-9-11-19-27(25)28/h2-19,28-30H,20H2,1H3,(H,34,37)/t30-/m0/s1 |
| InChIKey | GICNZXKLXPJYDB-PMERELPUSA-N |
| XLogP | 5.99 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|