C18H20FN3O4 — CID 137303571
1-ethyl-6-[2-fluoro-4-(2-methoxyethoxy)phenyl]-5-hydroxy-3-methyl-7H-pyrazolo[5,4-b]pyridin-4-one (PubChem CID 137303571) has the molecular formula C18H20FN3O4 and a molecular weight of 361.37 g/mol. Its IUPAC name is 1-ethyl-6-[2-fluoro-4-(2-methoxyethoxy)phenyl]-5-hydroxy-3-methyl-7H-pyrazolo[5,4-b]pyridin-4-one.
| Compound Name | 1-ethyl-6-[2-fluoro-4-(2-methoxyethoxy)phenyl]-5-hydroxy-3-methyl-7H-pyrazolo[5,4-b]pyridin-4-one |
|---|---|
| PubChem CID | 137303571 |
| Molecular Formula | C18H20FN3O4 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-ethyl-6-[2-fluoro-4-(2-methoxyethoxy)phenyl]-5-hydroxy-3-methyl-7H-pyrazolo[5,4-b]pyridin-4-one |
| SMILES | CCn1nc(C)c2c(=O)c(O)c(-c3ccc(OCCOC)cc3F)[nH]c21 |
| InChI | InChI=1S/C18H20FN3O4/c1-4-22-18-14(10(2)21-22)16(23)17(24)15(20-18)12-6-5-11(9-13(12)19)26-8-7-25-3/h5-6,9,24H,4,7-8H2,1-3H3,(H,20,23) |
| InChIKey | FPLXWAISQJFMNA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|