C11H10N2O4S — CID 137305428
3-methoxy-2-[(5-oxo-4H-1,2,4-thiadiazol-3-yl)methoxy]benzaldehyde (PubChem CID 137305428) has the molecular formula C11H10N2O4S and a molecular weight of 266.28 g/mol. Its IUPAC name is 3-methoxy-2-[(5-oxo-4H-1,2,4-thiadiazol-3-yl)methoxy]benzaldehyde.
| Compound Name | 3-methoxy-2-[(5-oxo-4H-1,2,4-thiadiazol-3-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 137305428 |
| Molecular Formula | C11H10N2O4S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 3-methoxy-2-[(5-oxo-4H-1,2,4-thiadiazol-3-yl)methoxy]benzaldehyde |
| SMILES | COc1cccc(C=O)c1OCc1nsc(=O)[nH]1 |
| InChI | InChI=1S/C11H10N2O4S/c1-16-8-4-2-3-7(5-14)10(8)17-6-9-12-11(15)18-13-9/h2-5H,6H2,1H3,(H,12,13,15) |
| InChIKey | JCSZFMOSQWZGDP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|