C10H14N2O — CID 137306452
5-but-3-en-2-yl-2,4-dimethyl-1H-pyrimidin-6-one (PubChem CID 137306452) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 5-but-3-en-2-yl-2,4-dimethyl-1H-pyrimidin-6-one.
| Compound Name | 5-but-3-en-2-yl-2,4-dimethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137306452 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 5-but-3-en-2-yl-2,4-dimethyl-1H-pyrimidin-6-one |
| SMILES | C=CC(C)c1c(C)nc(C)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O/c1-5-6(2)9-7(3)11-8(4)12-10(9)13/h5-6H,1H2,2-4H3,(H,11,12,13) |
| InChIKey | ZUXNXYZFVCBAGG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|