C30H28N2O2 — CID 137309329
1-(2-hydroxy-3-pyridin-2-yl-5,6,7,8-tetrahydronaphthalen-1-yl)-3-pyridin-2-yl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 137309329) has the molecular formula C30H28N2O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-(2-hydroxy-3-pyridin-2-yl-5,6,7,8-tetrahydronaphthalen-1-yl)-3-pyridin-2-yl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 1-(2-hydroxy-3-pyridin-2-yl-5,6,7,8-tetrahydronaphthalen-1-yl)-3-pyridin-2-yl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 137309329 |
| Molecular Formula | C30H28N2O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 1-(2-hydroxy-3-pyridin-2-yl-5,6,7,8-tetrahydronaphthalen-1-yl)-3-pyridin-2-yl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | Oc1c(-c2ccccn2)cc2c(c1-c1c(O)c(-c3ccccn3)cc3c1CCCC3)CCCC2 |
| InChI | InChI=1S/C30H28N2O2/c33-29-23(25-13-5-7-15-31-25)17-19-9-1-3-11-21(19)27(29)28-22-12-4-2-10-20(22)18-24(30(28)34)26-14-6-8-16-32-26/h5-8,13-18,33-34H,1-4,9-12H2 |
| InChIKey | VZBGGXAYZMEJRH-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |