About 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine
4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine (PubChem CID 137313587) has the molecular formula C23H16N4
and a molecular weight of 348.41 g/mol. Its IUPAC name is 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine.
Molecular Properties
| Compound Name | 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine |
| PubChem CID | 137313587 |
| Molecular Formula | C23H16N4 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine |
| SMILES | c1ccc(C2=Nc3ccc4ccccc4c3C(c3ccncc3)=NN2)cc1 |
| InChI | InChI=1S/C23H16N4/c1-2-7-18(8-3-1)23-25-20-11-10-16-6-4-5-9-19(16)21(20)22(26-27-23)17-12-14-24-15-13-17/h1-15H,(H,25,27) |
| InChIKey | RXROJQMOHCCSCS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine?
The IUPAC name of 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine (CID 137313587) is 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine.
What is the SMILES notation for 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine?
The canonical SMILES for 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine is c1ccc(C2=Nc3ccc4ccccc4c3C(c3ccncc3)=NN2)cc1.
What is the InChIKey of 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine?
The InChIKey is RXROJQMOHCCSCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N4/c1-2-7-18(8-3-1)23-25-20-11-10-16-6-4-5-9-19(16)21(20)22(26-27-23)17-12-14-24-15-13-17/h1-15H,(H,25,27).
What are the key properties of 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine?
4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine has a molecular weight of 348.41 g/mol, XLogP of 4.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1-pyridin-4-yl-3H-benzo[g][1,3,4]benzotriazepine is sourced from PubChem (CID 137313587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).