C12H9ClN2O4 — CID 137314859
2-[(4-chlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid (PubChem CID 137314859) has the molecular formula C12H9ClN2O4 and a molecular weight of 280.67 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 2-[(4-chlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 137314859 |
| Molecular Formula | C12H9ClN2O4 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1nc(Cc2ccc(Cl)cc2)[nH]c(=O)c1O |
| InChI | InChI=1S/C12H9ClN2O4/c13-7-3-1-6(2-4-7)5-8-14-9(12(18)19)10(16)11(17)15-8/h1-4,16H,5H2,(H,18,19)(H,14,15,17) |
| InChIKey | CXPARKWGPNKFSP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |