C23H27N3O3 — CID 137315328
2-(2-tert-butylphenoxy)-N-ethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide (PubChem CID 137315328) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-(2-tert-butylphenoxy)-N-ethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide.
| Compound Name | 2-(2-tert-butylphenoxy)-N-ethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 137315328 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-(2-tert-butylphenoxy)-N-ethyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide |
| SMILES | CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)COc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C23H27N3O3/c1-5-26(14-20-24-18-12-8-6-10-16(18)22(28)25-20)21(27)15-29-19-13-9-7-11-17(19)23(2,3)4/h6-13H,5,14-15H2,1-4H3,(H,24,25,28) |
| InChIKey | LVWTWCWGBMVFBE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |